5-Bromo-2-iodo-3-methoxypyridine
Catalog No: FT-0678317
CAS No: 944805-60-1
- Chemical Name: 5-Bromo-2-iodo-3-methoxypyridine
- Molecular Formula: C6H5BrINO
- Molecular Weight: 313.92
- InChI Key: JHZQBZOJQDBRHT-UHFFFAOYSA-N
- InChI: InChI=1S/C6H5BrINO/c1-10-5-2-4(7)3-9-6(5)8/h2-3H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 313.91800 |
| Density: | 2.166g/cm3 |
| CAS: | 944805-60-1 |
| Bolling_Point: | 298.6ºC at 760 mmHg |
| Product_Name: | 5-bromo-2-iodo-3-methoxypyridine |
| Melting_Point: | N/A |
| Flash_Point: | 134.4ºC |
| MF: | C6H5BrINO |
| Density: | 2.166g/cm3 |
|---|---|
| LogP: | 2.45730 |
| Flash_Point: | 134.4ºC |
| Refractive_Index: | 1.63 |
| FW: | 313.91800 |
| PSA: | 22.12000 |
| MF: | C6H5BrINO |
| Bolling_Point: | 298.6ºC at 760 mmHg |
| Exact_Mass: | 312.86000 |
| Hazard_Codes: | Xi |
|---|---|
| Warning_Statement: | P280-P304 + P340 + P312-P305 + P351 + P338-P337 + P313 |
| Safety_Statements: | H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)